C19H12F3N3O5 — CID 155669377
N-[1-[2-(cyano-fluoro-nitromethyl)phenyl]cyclopropyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide (PubChem CID 155669377) has the molecular formula C19H12F3N3O5 and a molecular weight of 419.32 g/mol. Its IUPAC name is N-[1-[2-(cyano-fluoro-nitromethyl)phenyl]cyclopropyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[2-(cyano-fluoro-nitromethyl)phenyl]cyclopropyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 155669377 |
| Molecular Formula | C19H12F3N3O5 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | N-[1-[2-(cyano-fluoro-nitromethyl)phenyl]cyclopropyl]-2,2-difluoro-1,3-benzodioxole-5-carboxamide |
| SMILES | N#CC(F)(c1ccccc1C1(NC(=O)c2ccc3c(c2)OC(F)(F)O3)CC1)[N+](=O)[O-] |
| InChI | InChI=1S/C19H12F3N3O5/c20-18(10-23,25(27)28)13-4-2-1-3-12(13)17(7-8-17)24-16(26)11-5-6-14-15(9-11)30-19(21,22)29-14/h1-6,9H,7-8H2,(H,24,26) |
| InChIKey | VFJMQDKLMLBBKI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|