C18H15BrF2N2O3 — CID 166359349
1-[1-(2-bromophenyl)cyclobutyl]-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea (PubChem CID 166359349) has the molecular formula C18H15BrF2N2O3 and a molecular weight of 425.23 g/mol. Its IUPAC name is 1-[1-(2-bromophenyl)cyclobutyl]-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea.
| Compound Name | 1-[1-(2-bromophenyl)cyclobutyl]-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea |
|---|---|
| PubChem CID | 166359349 |
| Molecular Formula | C18H15BrF2N2O3 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 1-[1-(2-bromophenyl)cyclobutyl]-3-(2,2-difluoro-1,3-benzodioxol-5-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OC(F)(F)O2)NC1(c2ccccc2Br)CCC1 |
| InChI | InChI=1S/C18H15BrF2N2O3/c19-13-5-2-1-4-12(13)17(8-3-9-17)23-16(24)22-11-6-7-14-15(10-11)26-18(20,21)25-14/h1-2,4-7,10H,3,8-9H2,(H2,22,23,24) |
| InChIKey | IMYHFMMKNUJGNZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |