C32H32N2O4 — CID 155674084
ethyl 4-[1,3-dibenzyl-2,4-dioxo-6-[(E)-2-phenylethenyl]pyrimidin-5-yl]butanoate (PubChem CID 155674084) has the molecular formula C32H32N2O4 and a molecular weight of 508.62 g/mol. Its IUPAC name is ethyl 4-[1,3-dibenzyl-2,4-dioxo-6-[(E)-2-phenylethenyl]pyrimidin-5-yl]butanoate.
| Compound Name | ethyl 4-[1,3-dibenzyl-2,4-dioxo-6-[(E)-2-phenylethenyl]pyrimidin-5-yl]butanoate |
|---|---|
| PubChem CID | 155674084 |
| Molecular Formula | C32H32N2O4 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | ethyl 4-[1,3-dibenzyl-2,4-dioxo-6-[(E)-2-phenylethenyl]pyrimidin-5-yl]butanoate |
| SMILES | CCOC(=O)CCCc1c(/C=C/c2ccccc2)n(Cc2ccccc2)c(=O)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C32H32N2O4/c1-2-38-30(35)20-12-19-28-29(22-21-25-13-6-3-7-14-25)33(23-26-15-8-4-9-16-26)32(37)34(31(28)36)24-27-17-10-5-11-18-27/h3-11,13-18,21-22H,2,12,19-20,23-24H2,1H3/b22-21+ |
| InChIKey | CASSZTRHXUCAEJ-QURGRASLSA-N |
| XLogP | 5.16 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |