C25H16BrF2N5O5S — CID 155675058
5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(6-methoxypyridazin-3-yl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 155675058) has the molecular formula C25H16BrF2N5O5S and a molecular weight of 616.40 g/mol. Its IUPAC name is 5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(6-methoxypyridazin-3-yl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(6-methoxypyridazin-3-yl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155675058 |
| Molecular Formula | C25H16BrF2N5O5S |
| Molecular Weight | 616.40 g/mol |
| Exact Mass | 615.00 |
| IUPAC Name | 5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(6-methoxypyridazin-3-yl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(-n2c(=O)c3c(CBr)c(-c4ccc([N+](=O)[O-])cc4)sc3n(Cc3c(F)cccc3F)c2=O)nn1 |
| InChI | InChI=1S/C25H16BrF2N5O5S/c1-38-20-10-9-19(29-30-20)32-23(34)21-15(11-26)22(13-5-7-14(8-6-13)33(36)37)39-24(21)31(25(32)35)12-16-17(27)3-2-4-18(16)28/h2-10H,11-12H2,1H3 |
| InChIKey | UDRNRODKEXHODI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 122.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|