C27H18BrF2N3O6S2 — CID 155664333
5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(4-methylsulfonylphenyl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 155664333) has the molecular formula C27H18BrF2N3O6S2 and a molecular weight of 662.49 g/mol. Its IUPAC name is 5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(4-methylsulfonylphenyl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(4-methylsulfonylphenyl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155664333 |
| Molecular Formula | C27H18BrF2N3O6S2 |
| Molecular Weight | 662.49 g/mol |
| Exact Mass | 660.98 |
| IUPAC Name | 5-(bromomethyl)-1-[(2,6-difluorophenyl)methyl]-3-(4-methylsulfonylphenyl)-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CS(=O)(=O)c1ccc(-n2c(=O)c3c(CBr)c(-c4ccc([N+](=O)[O-])cc4)sc3n(Cc3c(F)cccc3F)c2=O)cc1 |
| InChI | InChI=1S/C27H18BrF2N3O6S2/c1-41(38,39)18-11-9-16(10-12-18)32-25(34)23-19(13-28)24(15-5-7-17(8-6-15)33(36)37)40-26(23)31(27(32)35)14-20-21(29)3-2-4-22(20)30/h2-12H,13-14H2,1H3 |
| InChIKey | CKKWQFCRXNKPOL-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 121.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|