C28H21F4N5O5S — CID 162514302
3-[6-(difluoromethoxy)-2-pyridinyl]-1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 162514302) has the molecular formula C28H21F4N5O5S and a molecular weight of 615.57 g/mol. Its IUPAC name is 3-[6-(difluoromethoxy)-2-pyridinyl]-1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 3-[6-(difluoromethoxy)-2-pyridinyl]-1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162514302 |
| Molecular Formula | C28H21F4N5O5S |
| Molecular Weight | 615.57 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | 3-[6-(difluoromethoxy)-2-pyridinyl]-1-[(2,6-difluorophenyl)methyl]-5-[(dimethylamino)methyl]-6-(4-nitrophenyl)thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | CN(C)Cc1c(-c2ccc([N+](=O)[O-])cc2)sc2c1c(=O)n(-c1cccc(OC(F)F)n1)c(=O)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C28H21F4N5O5S/c1-34(2)13-18-23-25(38)36(21-7-4-8-22(33-21)42-27(31)32)28(39)35(14-17-19(29)5-3-6-20(17)30)26(23)43-24(18)15-9-11-16(12-10-15)37(40)41/h3-12,27H,13-14H2,1-2H3 |
| InChIKey | SGXCZSKIXRPXNP-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 112.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|