C30H23F2N5O5S — CID 155674054
1-[(2,6-difluorophenyl)methyl]-5-methyl-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione (PubChem CID 155674054) has the molecular formula C30H23F2N5O5S and a molecular weight of 603.61 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-5-methyl-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-5-methyl-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 155674054 |
| Molecular Formula | C30H23F2N5O5S |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-5-methyl-6-(4-nitrophenyl)-3-[6-(2-oxopiperidin-1-yl)-2-pyridinyl]thieno[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1c(-c2ccc([N+](=O)[O-])cc2)sc2c1c(=O)n(-c1cccc(N3CCCCC3=O)n1)c(=O)n2Cc1c(F)cccc1F |
| InChI | InChI=1S/C30H23F2N5O5S/c1-17-26-28(39)36(24-9-5-8-23(33-24)34-15-3-2-10-25(34)38)30(40)35(16-20-21(31)6-4-7-22(20)32)29(26)43-27(17)18-11-13-19(14-12-18)37(41)42/h4-9,11-14H,2-3,10,15-16H2,1H3 |
| InChIKey | NENVYPRWBGZATF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 120.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|