C20H20BrFN6O6S — CID 155675379
N'-(3-bromo-4-fluorophenyl)-4-(3-methylsulfonylpropylamino)-N-[(4-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155675379) has the molecular formula C20H20BrFN6O6S and a molecular weight of 571.39 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-(3-methylsulfonylpropylamino)-N-[(4-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-(3-methylsulfonylpropylamino)-N-[(4-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155675379 |
| Molecular Formula | C20H20BrFN6O6S |
| Molecular Weight | 571.39 g/mol |
| Exact Mass | 570.03 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-(3-methylsulfonylpropylamino)-N-[(4-nitrophenyl)methoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)CCCNc1nonc1/C(=N/c1ccc(F)c(Br)c1)NOCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20BrFN6O6S/c1-35(31,32)10-2-9-23-19-18(25-34-27-19)20(24-14-5-8-17(22)16(21)11-14)26-33-12-13-3-6-15(7-4-13)28(29)30/h3-8,11H,2,9-10,12H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | XNQMJYPPOSBEFP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 161.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|