C15H25NO2Si — CID 155681345
N-tert-butyl-2-methoxy-4-trimethylsilylbenzamide (PubChem CID 155681345) has the molecular formula C15H25NO2Si and a molecular weight of 279.46 g/mol. Its IUPAC name is N-tert-butyl-2-methoxy-4-trimethylsilylbenzamide.
| Compound Name | N-tert-butyl-2-methoxy-4-trimethylsilylbenzamide |
|---|---|
| PubChem CID | 155681345 |
| Molecular Formula | C15H25NO2Si |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-tert-butyl-2-methoxy-4-trimethylsilylbenzamide |
| SMILES | COc1cc([Si](C)(C)C)ccc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C15H25NO2Si/c1-15(2,3)16-14(17)12-9-8-11(19(5,6)7)10-13(12)18-4/h8-10H,1-7H3,(H,16,17) |
| InChIKey | HMPNBTASFRJAGA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|