C26H27FN4O2 — CID 155683140
4-cyano-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]-N'-(2-hydroxyethyl)benzohydrazide (PubChem CID 155683140) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-cyano-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]-N'-(2-hydroxyethyl)benzohydrazide.
| Compound Name | 4-cyano-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]-N'-(2-hydroxyethyl)benzohydrazide |
|---|---|
| PubChem CID | 155683140 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 4-cyano-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]-N'-(2-hydroxyethyl)benzohydrazide |
| SMILES | N#Cc1ccc(C(=O)NN(CCO)CC2CCC(c3ccnc4ccc(F)cc34)CC2)cc1 |
| InChI | InChI=1S/C26H27FN4O2/c27-22-9-10-25-24(15-22)23(11-12-29-25)20-5-3-19(4-6-20)17-31(13-14-32)30-26(33)21-7-1-18(16-28)2-8-21/h1-2,7-12,15,19-20,32H,3-6,13-14,17H2,(H,30,33) |
| InChIKey | UIDHOWFKPCXZKB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|