C25H26FN5O — CID 155683146
4-cyano-N'-ethyl-N'-[[5-(6-fluoroquinolin-4-yl)piperidin-2-yl]methyl]benzohydrazide (PubChem CID 155683146) has the molecular formula C25H26FN5O and a molecular weight of 431.52 g/mol. Its IUPAC name is 4-cyano-N'-ethyl-N'-[[5-(6-fluoroquinolin-4-yl)piperidin-2-yl]methyl]benzohydrazide.
| Compound Name | 4-cyano-N'-ethyl-N'-[[5-(6-fluoroquinolin-4-yl)piperidin-2-yl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 155683146 |
| Molecular Formula | C25H26FN5O |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 4-cyano-N'-ethyl-N'-[[5-(6-fluoroquinolin-4-yl)piperidin-2-yl]methyl]benzohydrazide |
| SMILES | CCN(CC1CCC(c2ccnc3ccc(F)cc23)CN1)NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C25H26FN5O/c1-2-31(30-25(32)18-5-3-17(14-27)4-6-18)16-21-9-7-19(15-29-21)22-11-12-28-24-10-8-20(26)13-23(22)24/h3-6,8,10-13,19,21,29H,2,7,9,15-16H2,1H3,(H,30,32) |
| InChIKey | MCLYLXRIBUXJNS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|