C26H24FN5O — CID 155683150
4-cyano-N'-(cyanomethyl)-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]benzohydrazide (PubChem CID 155683150) has the molecular formula C26H24FN5O and a molecular weight of 441.51 g/mol. Its IUPAC name is 4-cyano-N'-(cyanomethyl)-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]benzohydrazide.
| Compound Name | 4-cyano-N'-(cyanomethyl)-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 155683150 |
| Molecular Formula | C26H24FN5O |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-cyano-N'-(cyanomethyl)-N'-[[4-(6-fluoroquinolin-4-yl)cyclohexyl]methyl]benzohydrazide |
| SMILES | N#CCN(CC1CCC(c2ccnc3ccc(F)cc23)CC1)NC(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C26H24FN5O/c27-22-9-10-25-24(15-22)23(11-13-30-25)20-5-3-19(4-6-20)17-32(14-12-28)31-26(33)21-7-1-18(16-29)2-8-21/h1-2,7-11,13,15,19-20H,3-6,14,17H2,(H,31,33) |
| InChIKey | OZGBEJPJHMUTRI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|