C23H21FN4O2 — CID 175084612
4-cyano-N-[[5-(6-fluoroquinolin-4-yl)oxan-2-yl]methyl]benzohydrazide (PubChem CID 175084612) has the molecular formula C23H21FN4O2 and a molecular weight of 404.45 g/mol. Its IUPAC name is 4-cyano-N-[[5-(6-fluoroquinolin-4-yl)oxan-2-yl]methyl]benzohydrazide.
| Compound Name | 4-cyano-N-[[5-(6-fluoroquinolin-4-yl)oxan-2-yl]methyl]benzohydrazide |
|---|---|
| PubChem CID | 175084612 |
| Molecular Formula | C23H21FN4O2 |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 4-cyano-N-[[5-(6-fluoroquinolin-4-yl)oxan-2-yl]methyl]benzohydrazide |
| SMILES | N#Cc1ccc(C(=O)N(N)CC2CCC(c3ccnc4ccc(F)cc34)CO2)cc1 |
| InChI | InChI=1S/C23H21FN4O2/c24-18-6-8-22-21(11-18)20(9-10-27-22)17-5-7-19(30-14-17)13-28(26)23(29)16-3-1-15(12-25)2-4-16/h1-4,6,8-11,17,19H,5,7,13-14,26H2 |
| InChIKey | UEOLCCRBNKGEIN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|