C23H21FN4O — CID 121332539
1-(4-cyanophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]urea (PubChem CID 121332539) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]urea |
|---|---|
| PubChem CID | 121332539 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[4-(6-fluoroquinolin-4-yl)cyclohexyl]urea |
| SMILES | N#Cc1ccc(NC(=O)NC2CCC(c3ccnc4ccc(F)cc34)CC2)cc1 |
| InChI | InChI=1S/C23H21FN4O/c24-17-5-10-22-21(13-17)20(11-12-26-22)16-3-8-19(9-4-16)28-23(29)27-18-6-1-15(14-25)2-7-18/h1-2,5-7,10-13,16,19H,3-4,8-9H2,(H2,27,28,29) |
| InChIKey | ZHKIIRSWEAVDAF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |