C16H16F4N2O2 — CID 155691123
tert-butyl N-[2,4-bis(difluoromethyl)quinolin-3-yl]carbamate (PubChem CID 155691123) has the molecular formula C16H16F4N2O2 and a molecular weight of 344.31 g/mol. Its IUPAC name is tert-butyl N-[2,4-bis(difluoromethyl)quinolin-3-yl]carbamate.
| Compound Name | tert-butyl N-[2,4-bis(difluoromethyl)quinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 155691123 |
| Molecular Formula | C16H16F4N2O2 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | tert-butyl N-[2,4-bis(difluoromethyl)quinolin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(C(F)F)nc2ccccc2c1C(F)F |
| InChI | InChI=1S/C16H16F4N2O2/c1-16(2,3)24-15(23)22-11-10(13(17)18)8-6-4-5-7-9(8)21-12(11)14(19)20/h4-7,13-14H,1-3H3,(H,22,23) |
| InChIKey | KUKIMQLTZFCLQD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |