C12H15N2+ — CID 155692742
3-(aziridin-2-yl)-4,5-bis(ethenyl)-1-methylpyridin-1-ium (PubChem CID 155692742) has the molecular formula C12H15N2+ and a molecular weight of 187.27 g/mol. Its IUPAC name is 3-(aziridin-2-yl)-4,5-bis(ethenyl)-1-methylpyridin-1-ium.
| Compound Name | 3-(aziridin-2-yl)-4,5-bis(ethenyl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 155692742 |
| Molecular Formula | C12H15N2+ |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 3-(aziridin-2-yl)-4,5-bis(ethenyl)-1-methylpyridin-1-ium |
| SMILES | C=Cc1c[n+](C)cc(C2CN2)c1C=C |
| InChI | InChI=1S/C12H15N2/c1-4-9-7-14(3)8-11(10(9)5-2)12-6-13-12/h4-5,7-8,12-13H,1-2,6H2,3H3/q+1 |
| InChIKey | ICJJTKIUEMOFKD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 25.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|