About ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane
ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane (PubChem CID 155692872) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane.
Molecular Properties
| Compound Name | ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane |
| PubChem CID | 155692872 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane |
| SMILES | CC.CCC(=O)Nc1c(C)cccc1C=O.CCOC |
| InChI | InChI=1S/C11H13NO2.C3H8O.C2H6/c1-3-10(14)12-11-8(2)5-4-6-9(11)7-13;1-3-4-2;1-2/h4-7H,3H2,1-2H3,(H,12,14);3H2,1-2H3;1-2H3 |
| InChIKey | NIYCXWXQPNWFMK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane?
The IUPAC name of ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane (CID 155692872) is ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane.
What is the SMILES notation for ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane?
The canonical SMILES for ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane is CC.CCC(=O)Nc1c(C)cccc1C=O.CCOC.
What is the InChIKey of ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane?
The InChIKey is NIYCXWXQPNWFMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2.C3H8O.C2H6/c1-3-10(14)12-11-8(2)5-4-6-9(11)7-13;1-3-4-2;1-2/h4-7H,3H2,1-2H3,(H,12,14);3H2,1-2H3;1-2H3.
What are the key properties of ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane?
ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane has a molecular weight of 281.40 g/mol, XLogP of 3.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-formyl-6-methylphenyl)propanamide;methoxyethane is sourced from PubChem (CID 155692872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).