C14H14N5O4Y- — CID 155694023
5-(hydroxyamino)-1,3-dihydrobenzimidazol-2-one;(5-methyl-2-nitrophenyl)azanide;yttrium (PubChem CID 155694023) has the molecular formula C14H14N5O4Y- and a molecular weight of 405.20 g/mol. Its IUPAC name is 5-(hydroxyamino)-1,3-dihydrobenzimidazol-2-one;(5-methyl-2-nitrophenyl)azanide;yttrium.
| Compound Name | 5-(hydroxyamino)-1,3-dihydrobenzimidazol-2-one;(5-methyl-2-nitrophenyl)azanide;yttrium |
|---|---|
| PubChem CID | 155694023 |
| Molecular Formula | C14H14N5O4Y- |
| Molecular Weight | 405.20 g/mol |
| Exact Mass | 405.01 |
| IUPAC Name | 5-(hydroxyamino)-1,3-dihydrobenzimidazol-2-one;(5-methyl-2-nitrophenyl)azanide;yttrium |
| SMILES | Cc1ccc([N+](=O)[O-])c([NH-])c1.O=c1[nH]c2ccc(NO)cc2[nH]1.[Y] |
| InChI | InChI=1S/C7H7N3O2.C7H7N2O2.Y/c11-7-8-5-2-1-4(10-12)3-6(5)9-7;1-5-2-3-7(9(10)11)6(8)4-5;/h1-3,10,12H,(H2,8,9,11);2-4,8H,1H3;/q;-1; |
| InChIKey | XIRMJVNULWLBHQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 147.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|