C29H37ClN2O — CID 155697271
2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carbaldehyde (PubChem CID 155697271) has the molecular formula C29H37ClN2O and a molecular weight of 465.08 g/mol. Its IUPAC name is 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carbaldehyde.
| Compound Name | 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 155697271 |
| Molecular Formula | C29H37ClN2O |
| Molecular Weight | 465.08 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 2-[4-[2-chloro-4-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)anilino]anilino]cyclopentane-1-carbaldehyde |
| SMILES | CC1CC2CC(C1)CC(C)(c1ccc(Nc3ccc(NC4CCCC4C=O)cc3)c(Cl)c1)C2 |
| InChI | InChI=1S/C29H37ClN2O/c1-19-12-20-14-21(13-19)17-29(2,16-20)23-6-11-28(26(30)15-23)32-25-9-7-24(8-10-25)31-27-5-3-4-22(27)18-33/h6-11,15,18-22,27,31-32H,3-5,12-14,16-17H2,1-2H3 |
| InChIKey | LKEWWZFITBHDIQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.08 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|