C21H20ClNO — CID 155704159
(E)-3-(4-chlorophenyl)-2-phenyl-1-(2,3,4,7-tetrahydro-1H-azepin-5-yl)prop-2-en-1-one (PubChem CID 155704159) has the molecular formula C21H20ClNO and a molecular weight of 337.85 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-2-phenyl-1-(2,3,4,7-tetrahydro-1H-azepin-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-2-phenyl-1-(2,3,4,7-tetrahydro-1H-azepin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155704159 |
| Molecular Formula | C21H20ClNO |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-2-phenyl-1-(2,3,4,7-tetrahydro-1H-azepin-5-yl)prop-2-en-1-one |
| SMILES | O=C(C1=CCNCCC1)/C(=C/c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H20ClNO/c22-19-10-8-16(9-11-19)15-20(17-5-2-1-3-6-17)21(24)18-7-4-13-23-14-12-18/h1-3,5-6,8-12,15,23H,4,7,13-14H2/b20-15+ |
| InChIKey | ZYZJDRAFGNIDJZ-HMMYKYKNSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|