C30H26O2 — CID 91405065
2,3-dibenzylidene-1-(cyclohexen-1-yl)-4-phenylbutane-1,4-dione (PubChem CID 91405065) has the molecular formula C30H26O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2,3-dibenzylidene-1-(cyclohexen-1-yl)-4-phenylbutane-1,4-dione.
| Compound Name | 2,3-dibenzylidene-1-(cyclohexen-1-yl)-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 91405065 |
| Molecular Formula | C30H26O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2,3-dibenzylidene-1-(cyclohexen-1-yl)-4-phenylbutane-1,4-dione |
| SMILES | O=C(C1=CCCCC1)C(=Cc1ccccc1)C(=Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H26O2/c31-29(25-17-9-3-10-18-25)27(21-23-13-5-1-6-14-23)28(22-24-15-7-2-8-16-24)30(32)26-19-11-4-12-20-26/h1-3,5-10,13-19,21-22H,4,11-12,20H2 |
| InChIKey | HOFLSVMIESTWMD-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|