C31H27N3O7 — CID 155704576
(4-nitrophenyl) 10-formamido-4-methoxy-5-phenylmethoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8-carboxylate (PubChem CID 155704576) has the molecular formula C31H27N3O7 and a molecular weight of 553.57 g/mol. Its IUPAC name is (4-nitrophenyl) 10-formamido-4-methoxy-5-phenylmethoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8-carboxylate.
| Compound Name | (4-nitrophenyl) 10-formamido-4-methoxy-5-phenylmethoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8-carboxylate |
|---|---|
| PubChem CID | 155704576 |
| Molecular Formula | C31H27N3O7 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | (4-nitrophenyl) 10-formamido-4-methoxy-5-phenylmethoxy-8-azatricyclo[10.4.0.02,7]hexadeca-1(16),2,4,6,12,14-hexaene-8-carboxylate |
| SMILES | COc1cc2c(cc1OCc1ccccc1)N(C(=O)Oc1ccc([N+](=O)[O-])cc1)CC(NC=O)Cc1ccccc1-2 |
| InChI | InChI=1S/C31H27N3O7/c1-39-29-16-27-26-10-6-5-9-22(26)15-23(32-20-35)18-33(31(36)41-25-13-11-24(12-14-25)34(37)38)28(27)17-30(29)40-19-21-7-3-2-4-8-21/h2-14,16-17,20,23H,15,18-19H2,1H3,(H,32,35) |
| InChIKey | HAGIWFCDDKARBV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|