About CID 155709010
CID 155709010 (PubChem CID 155709010) has the molecular formula C16H17FN3O3Pb
and a molecular weight of 525.53 g/mol.
Molecular Properties
| Compound Name | CID 155709010 |
| PubChem CID | 155709010 |
| Molecular Formula | C16H17FN3O3Pb |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | — |
| SMILES | CC1CC(n2cc(-c3cccc(F)c3)nn2)C2OC([Pb])OCC2O1 |
| InChI | InChI=1S/C16H17FN3O3.Pb/c1-10-5-14(16-15(23-10)8-21-9-22-16)20-7-13(18-19-20)11-3-2-4-12(17)6-11;/h2-4,6-7,9-10,14-16H,5,8H2,1H3; |
| InChIKey | HZGXFCFFRCEWKE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 155709010 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155709010?
The IUPAC name of CID 155709010 (CID 155709010) is not available.
What is the SMILES notation for CID 155709010?
The canonical SMILES for CID 155709010 is CC1CC(n2cc(-c3cccc(F)c3)nn2)C2OC([Pb])OCC2O1.
What is the InChIKey of CID 155709010?
The InChIKey is HZGXFCFFRCEWKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN3O3.Pb/c1-10-5-14(16-15(23-10)8-21-9-22-16)20-7-13(18-19-20)11-3-2-4-12(17)6-11;/h2-4,6-7,9-10,14-16H,5,8H2,1H3;.
What are the key properties of CID 155709010?
CID 155709010 has a molecular weight of 525.53 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155709010 is sourced from PubChem (CID 155709010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).