C16H17FN3O3Pb — CID 155709010
CID 155709010 (PubChem CID 155709010) has the molecular formula C16H17FN3O3Pb and a molecular weight of 525.53 g/mol.
| Compound Name | CID 155709010 |
|---|---|
| PubChem CID | 155709010 |
| Molecular Formula | C16H17FN3O3Pb |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | — |
| SMILES | CC1CC(n2cc(-c3cccc(F)c3)nn2)C2OC([Pb])OCC2O1 |
| InChI | InChI=1S/C16H17FN3O3.Pb/c1-10-5-14(16-15(23-10)8-21-9-22-16)20-7-13(18-19-20)11-3-2-4-12(17)6-11;/h2-4,6-7,9-10,14-16H,5,8H2,1H3; |
| InChIKey | HZGXFCFFRCEWKE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |