C21H24FN3O4 — CID 170691976
1-[(4aR,6R,7R,8R,8aR)-7-methoxy-2,2-dimethyl-6-prop-2-ynyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(3-fluorophenyl)triazole (PubChem CID 170691976) has the molecular formula C21H24FN3O4 and a molecular weight of 401.44 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,8R,8aR)-7-methoxy-2,2-dimethyl-6-prop-2-ynyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(3-fluorophenyl)triazole.
| Compound Name | 1-[(4aR,6R,7R,8R,8aR)-7-methoxy-2,2-dimethyl-6-prop-2-ynyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(3-fluorophenyl)triazole |
|---|---|
| PubChem CID | 170691976 |
| Molecular Formula | C21H24FN3O4 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[(4aR,6R,7R,8R,8aR)-7-methoxy-2,2-dimethyl-6-prop-2-ynyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-(3-fluorophenyl)triazole |
| SMILES | C#CC[C@H]1O[C@@H]2COC(C)(C)O[C@@H]2[C@H](n2cc(-c3cccc(F)c3)nn2)[C@H]1OC |
| InChI | InChI=1S/C21H24FN3O4/c1-5-7-16-19(26-4)18(20-17(28-16)12-27-21(2,3)29-20)25-11-15(23-24-25)13-8-6-9-14(22)10-13/h1,6,8-11,16-20H,7,12H2,2-4H3/t16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | JISJLFPXTXJERS-UEDWAMCQSA-N |
| XLogP | 2.58 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|