C50H70N4O6 — CID 155715896
bis(tert-butyl 2-formylpyrrolidine-1-carboxylate);N-methyl-3-[3,3,7,7-tetramethyl-8-[3-(methylamino)phenyl]-1,2,5,6-tetrahydro-s-indacen-4-yl]aniline (PubChem CID 155715896) has the molecular formula C50H70N4O6 and a molecular weight of 823.13 g/mol. Its IUPAC name is bis(tert-butyl 2-formylpyrrolidine-1-carboxylate);N-methyl-3-[3,3,7,7-tetramethyl-8-[3-(methylamino)phenyl]-1,2,5,6-tetrahydro-s-indacen-4-yl]aniline.
| Compound Name | bis(tert-butyl 2-formylpyrrolidine-1-carboxylate);N-methyl-3-[3,3,7,7-tetramethyl-8-[3-(methylamino)phenyl]-1,2,5,6-tetrahydro-s-indacen-4-yl]aniline |
|---|---|
| PubChem CID | 155715896 |
| Molecular Formula | C50H70N4O6 |
| Molecular Weight | 823.13 g/mol |
| Exact Mass | 822.53 |
| IUPAC Name | bis(tert-butyl 2-formylpyrrolidine-1-carboxylate);N-methyl-3-[3,3,7,7-tetramethyl-8-[3-(methylamino)phenyl]-1,2,5,6-tetrahydro-s-indacen-4-yl]aniline |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C=O.CC(C)(C)OC(=O)N1CCCC1C=O.CNc1cccc(-c2c3c(c(-c4cccc(NC)c4)c4c2C(C)(C)CC4)C(C)(C)CC3)c1 |
| InChI | InChI=1S/C30H36N2.2C10H17NO3/c1-29(2)15-13-23-26(20-10-8-12-22(18-20)32-6)28-24(14-16-30(28,3)4)25(27(23)29)19-9-7-11-21(17-19)31-5;2*1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h7-12,17-18,31-32H,13-16H2,1-6H3;2*7-8H,4-6H2,1-3H3 |
| InChIKey | DYGPAEOBMALRCJ-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.13 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|