C20H27ClF4N6O3 — CID 155717851
N-(3-chloro-4-fluorophenyl)-2-methyl-1-oxaldehydoylpyrrolidine-3-carboxamide;(Z)-5,5,5-trifluoro-1-hydrazinyl-3-N-methylpent-1-ene-2,3-diamine (PubChem CID 155717851) has the molecular formula C20H27ClF4N6O3 and a molecular weight of 510.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-methyl-1-oxaldehydoylpyrrolidine-3-carboxamide;(Z)-5,5,5-trifluoro-1-hydrazinyl-3-N-methylpent-1-ene-2,3-diamine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-methyl-1-oxaldehydoylpyrrolidine-3-carboxamide;(Z)-5,5,5-trifluoro-1-hydrazinyl-3-N-methylpent-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 155717851 |
| Molecular Formula | C20H27ClF4N6O3 |
| Molecular Weight | 510.92 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-methyl-1-oxaldehydoylpyrrolidine-3-carboxamide;(Z)-5,5,5-trifluoro-1-hydrazinyl-3-N-methylpent-1-ene-2,3-diamine |
| SMILES | CC1C(C(=O)Nc2ccc(F)c(Cl)c2)CCN1C(=O)C=O.CNC(CC(F)(F)F)/C(N)=C/NN |
| InChI | InChI=1S/C14H14ClFN2O3.C6H13F3N4/c1-8-10(4-5-18(8)13(20)7-19)14(21)17-9-2-3-12(16)11(15)6-9;1-12-5(2-6(7,8)9)4(10)3-13-11/h2-3,6-8,10H,4-5H2,1H3,(H,17,21);3,5,12-13H,2,10-11H2,1H3/b;4-3- |
| InChIKey | HVJKTARCPKUITH-QGAMPUOQSA-N |
| XLogP | 1.64 |
| TPSA | 142.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.92 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|