C17H17ClF5N3O3 — CID 122513391
(2S,3R)-N-(3-chloro-4,5-difluorophenyl)-2-methyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxamide (PubChem CID 122513391) has the molecular formula C17H17ClF5N3O3 and a molecular weight of 441.78 g/mol. Its IUPAC name is (2S,3R)-N-(3-chloro-4,5-difluorophenyl)-2-methyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxamide.
| Compound Name | (2S,3R)-N-(3-chloro-4,5-difluorophenyl)-2-methyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 122513391 |
| Molecular Formula | C17H17ClF5N3O3 |
| Molecular Weight | 441.78 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | (2S,3R)-N-(3-chloro-4,5-difluorophenyl)-2-methyl-1-[2-oxo-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]acetyl]pyrrolidine-3-carboxamide |
| SMILES | C[C@H]1[C@H](C(=O)Nc2cc(F)c(F)c(Cl)c2)CCN1C(=O)C(=O)N[C@H](C)C(F)(F)F |
| InChI | InChI=1S/C17H17ClF5N3O3/c1-7-10(14(27)25-9-5-11(18)13(20)12(19)6-9)3-4-26(7)16(29)15(28)24-8(2)17(21,22)23/h5-8,10H,3-4H2,1-2H3,(H,24,28)(H,25,27)/t7-,8+,10+/m0/s1 |
| InChIKey | LHBNONPHOIJHPG-QXFUBDJGSA-N |
| XLogP | 2.86 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|