About sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid
sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid (PubChem CID 155718437) has the molecular formula C9H15NNaO2-
and a molecular weight of 192.21 g/mol. Its IUPAC name is sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid.
Molecular Properties
| Compound Name | sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid |
| PubChem CID | 155718437 |
| Molecular Formula | C9H15NNaO2- |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid |
| SMILES | [CH3-].[H]/N=C(CC)/C(=[C-]\C(=O)O)CC.[Na+] |
| InChI | InChI=1S/C8H12NO2.CH3.Na/c1-3-6(5-8(10)11)7(9)4-2;;/h9H,3-4H2,1-2H3,(H,10,11);1H3;/q2*-1;+1/b9-7+;; |
| InChIKey | ZJOITTZNBCZQNV-OJYIHNBOSA-N |
| XLogP | -0.91 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid?
The IUPAC name of sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid (CID 155718437) is sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid.
What is the SMILES notation for sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid?
The canonical SMILES for sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid is [CH3-].[H]/N=C(CC)/C(=[C-]\C(=O)O)CC.[Na+].
What is the InChIKey of sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid?
The InChIKey is ZJOITTZNBCZQNV-OJYIHNBOSA-N. The full InChI is InChI=1S/C8H12NO2.CH3.Na/c1-3-6(5-8(10)11)7(9)4-2;;/h9H,3-4H2,1-2H3,(H,10,11);1H3;/q2*-1;+1/b9-7+;;.
What are the key properties of sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid?
sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid has a molecular weight of 192.21 g/mol, XLogP of -0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;carbanide;3-ethyl-4-iminohex-2-enoic acid is sourced from PubChem (CID 155718437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).