C12H23NO — CID 123844466
3-imino-5,5,7,7-tetramethyloctan-4-one (PubChem CID 123844466) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 3-imino-5,5,7,7-tetramethyloctan-4-one.
| Compound Name | 3-imino-5,5,7,7-tetramethyloctan-4-one |
|---|---|
| PubChem CID | 123844466 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 3-imino-5,5,7,7-tetramethyloctan-4-one |
| SMILES | [H]/N=C(\CC)C(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H23NO/c1-7-9(13)10(14)12(5,6)8-11(2,3)4/h13H,7-8H2,1-6H3/b13-9+ |
| InChIKey | ZWXBXSQYOUCGSF-UKTHLTGXSA-N |
| XLogP | 3.45 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|