C13H24N2O3 — CID 173446881
3,5-dihydroxy-N,6,6-trimethyl-2-propanimidoylhept-2-enamide (PubChem CID 173446881) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3,5-dihydroxy-N,6,6-trimethyl-2-propanimidoylhept-2-enamide.
| Compound Name | 3,5-dihydroxy-N,6,6-trimethyl-2-propanimidoylhept-2-enamide |
|---|---|
| PubChem CID | 173446881 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 3,5-dihydroxy-N,6,6-trimethyl-2-propanimidoylhept-2-enamide |
| SMILES | [H]/N=C(\CC)C(C(=O)NC)=C(O)CC(O)C(C)(C)C |
| InChI | InChI=1S/C13H24N2O3/c1-6-8(14)11(12(18)15-5)9(16)7-10(17)13(2,3)4/h10,14,16-17H,6-7H2,1-5H3,(H,15,18)/b11-9?,14-8+ |
| InChIKey | CKJJQKADFFOJPW-RYBLYPMJSA-N |
| XLogP | 1.77 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|