C13H23F3N2O — CID 171493645
(E)-N,3-diethyl-4-imino-2-(trifluoromethyl)hex-2-enamide;ethane (PubChem CID 171493645) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is (E)-N,3-diethyl-4-imino-2-(trifluoromethyl)hex-2-enamide;ethane.
| Compound Name | (E)-N,3-diethyl-4-imino-2-(trifluoromethyl)hex-2-enamide;ethane |
|---|---|
| PubChem CID | 171493645 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (E)-N,3-diethyl-4-imino-2-(trifluoromethyl)hex-2-enamide;ethane |
| SMILES | CC.[H]/N=C(CC)/C(CC)=C(\C(=O)NCC)C(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O.C2H6/c1-4-7(8(15)5-2)9(11(12,13)14)10(17)16-6-3;1-2/h15H,4-6H2,1-3H3,(H,16,17);1-2H3/b9-7+,15-8+; |
| InChIKey | COKXXPOKVBPSHM-PYGVOWKASA-N |
| XLogP | 3.85 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|