C6H7F3N2O — CID 123221131
6,6,6-trifluoro-3,5-diiminohexan-2-one (PubChem CID 123221131) has the molecular formula C6H7F3N2O and a molecular weight of 180.13 g/mol. Its IUPAC name is 6,6,6-trifluoro-3,5-diiminohexan-2-one.
| Compound Name | 6,6,6-trifluoro-3,5-diiminohexan-2-one |
|---|---|
| PubChem CID | 123221131 |
| Molecular Formula | C6H7F3N2O |
| Molecular Weight | 180.13 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 6,6,6-trifluoro-3,5-diiminohexan-2-one |
| SMILES | [H]/N=C(/C/C(=N\[H])C(F)(F)F)C(C)=O |
| InChI | InChI=1S/C6H7F3N2O/c1-3(12)4(10)2-5(11)6(7,8)9/h10-11H,2H2,1H3/b10-4-,11-5+ |
| InChIKey | NENIJDNWFRZGCF-WIZYTBDYSA-N |
| XLogP | 1.57 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.13 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|