C14H29NO — CID 155718439
ethane;(4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one;molecular hydrogen (PubChem CID 155718439) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is ethane;(4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one;molecular hydrogen.
| Compound Name | ethane;(4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one;molecular hydrogen |
|---|---|
| PubChem CID | 155718439 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | ethane;(4E)-6-imino-4,7-dimethylocta-1,4-dien-3-one;molecular hydrogen |
| SMILES | CC.CC.[H]/N=C(/C=C(\C)C(=O)C=C)C(C)C.[H][H] |
| InChI | InChI=1S/C10H15NO.2C2H6.H2/c1-5-10(12)8(4)6-9(11)7(2)3;2*1-2;/h5-7,11H,1H2,2-4H3;2*1-2H3;1H/b8-6+,11-9-;;; |
| InChIKey | RPBLLUCTGPLMFA-IYHOJCMKSA-N |
| XLogP | 4.66 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|