C7H12N6O2 — CID 155720590
N-[1H-imidazol-5-ylmethyl(methylaminocarbamoyl)amino]formamide (PubChem CID 155720590) has the molecular formula C7H12N6O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is N-[1H-imidazol-5-ylmethyl(methylaminocarbamoyl)amino]formamide.
| Compound Name | N-[1H-imidazol-5-ylmethyl(methylaminocarbamoyl)amino]formamide |
|---|---|
| PubChem CID | 155720590 |
| Molecular Formula | C7H12N6O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-[1H-imidazol-5-ylmethyl(methylaminocarbamoyl)amino]formamide |
| SMILES | CNNC(=O)N(Cc1cnc[nH]1)NC=O |
| InChI | InChI=1S/C7H12N6O2/c1-8-12-7(15)13(11-5-14)3-6-2-9-4-10-6/h2,4-5,8H,3H2,1H3,(H,9,10)(H,11,14)(H,12,15) |
| InChIKey | QIMLVUZWIOBNLP-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|