C13H24N2O — CID 155721839
(5E)-6-methoxy-1-N,1-N,3-trimethyl-4-methylideneocta-5,7-diene-1,7-diamine (PubChem CID 155721839) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (5E)-6-methoxy-1-N,1-N,3-trimethyl-4-methylideneocta-5,7-diene-1,7-diamine.
| Compound Name | (5E)-6-methoxy-1-N,1-N,3-trimethyl-4-methylideneocta-5,7-diene-1,7-diamine |
|---|---|
| PubChem CID | 155721839 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (5E)-6-methoxy-1-N,1-N,3-trimethyl-4-methylideneocta-5,7-diene-1,7-diamine |
| SMILES | C=C(N)/C(=C\C(=C)C(C)CCN(C)C)OC |
| InChI | InChI=1S/C13H24N2O/c1-10(7-8-15(4)5)11(2)9-13(16-6)12(3)14/h9-10H,2-3,7-8,14H2,1,4-6H3/b13-9+ |
| InChIKey | VYORYAVVELYQBX-UKTHLTGXSA-N |
| XLogP | 2.13 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|