C10H23N3 — CID 166898967
1-N,1-N,5-N-trimethylhept-6-ene-1,5,6-triamine (PubChem CID 166898967) has the molecular formula C10H23N3 and a molecular weight of 185.31 g/mol. Its IUPAC name is 1-N,1-N,5-N-trimethylhept-6-ene-1,5,6-triamine.
| Compound Name | 1-N,1-N,5-N-trimethylhept-6-ene-1,5,6-triamine |
|---|---|
| PubChem CID | 166898967 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 1-N,1-N,5-N-trimethylhept-6-ene-1,5,6-triamine |
| SMILES | C=C(N)C(CCCCN(C)C)NC |
| InChI | InChI=1S/C10H23N3/c1-9(11)10(12-2)7-5-6-8-13(3)4/h10,12H,1,5-8,11H2,2-4H3 |
| InChIKey | IKODJGZEXDLOIT-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|