C36H49NOS — CID 155725723
(2Z)-1-[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-2-ethylidene-3-phenyl-6-propyldecan-1-one (PubChem CID 155725723) has the molecular formula C36H49NOS and a molecular weight of 543.86 g/mol. Its IUPAC name is (2Z)-1-[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-2-ethylidene-3-phenyl-6-propyldecan-1-one.
| Compound Name | (2Z)-1-[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-2-ethylidene-3-phenyl-6-propyldecan-1-one |
|---|---|
| PubChem CID | 155725723 |
| Molecular Formula | C36H49NOS |
| Molecular Weight | 543.86 g/mol |
| Exact Mass | 543.35 |
| IUPAC Name | (2Z)-1-[(6S)-6-tert-butyl-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl]-2-ethylidene-3-phenyl-6-propyldecan-1-one |
| SMILES | C/C=C(\C(=O)c1cc2cc3c(nc2s1)CC[C@H](C(C)(C)C)C3)C(CCC(CCC)CCCC)c1ccccc1 |
| InChI | InChI=1S/C36H49NOS/c1-7-10-15-25(14-8-2)18-20-31(26-16-12-11-13-17-26)30(9-3)34(38)33-24-28-22-27-23-29(36(4,5)6)19-21-32(27)37-35(28)39-33/h9,11-13,16-17,22,24-25,29,31H,7-8,10,14-15,18-21,23H2,1-6H3/b30-9-/t25?,29-,31?/m0/s1 |
| InChIKey | MCRVTQSKMAMVKW-BJVQOOFMSA-N |
| XLogP | 10.75 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.86 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|