C25H39N5O6 — CID 155726291
tert-butyl N-[2-[[3-(2-aminoethynyl)-5-methylbenzoyl]amino]ethyl]carbamate;tert-butyl N-(2-formamidoethyl)carbamate (PubChem CID 155726291) has the molecular formula C25H39N5O6 and a molecular weight of 505.62 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2-aminoethynyl)-5-methylbenzoyl]amino]ethyl]carbamate;tert-butyl N-(2-formamidoethyl)carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2-aminoethynyl)-5-methylbenzoyl]amino]ethyl]carbamate;tert-butyl N-(2-formamidoethyl)carbamate |
|---|---|
| PubChem CID | 155726291 |
| Molecular Formula | C25H39N5O6 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | tert-butyl N-[2-[[3-(2-aminoethynyl)-5-methylbenzoyl]amino]ethyl]carbamate;tert-butyl N-(2-formamidoethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC=O.Cc1cc(C#CN)cc(C(=O)NCCNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H23N3O3.C8H16N2O3/c1-12-9-13(5-6-18)11-14(10-12)15(21)19-7-8-20-16(22)23-17(2,3)4;1-8(2,3)13-7(12)10-5-4-9-6-11/h9-11H,7-8,18H2,1-4H3,(H,19,21)(H,20,22);6H,4-5H2,1-3H3,(H,9,11)(H,10,12) |
| InChIKey | IXYDDKDKWZBGPR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 160.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|