C26H30BN5 — CID 155732209
CID 155732209 (PubChem CID 155732209) has the molecular formula C26H30BN5 and a molecular weight of 423.37 g/mol.
| Compound Name | CID 155732209 |
|---|---|
| PubChem CID | 155732209 |
| Molecular Formula | C26H30BN5 |
| Molecular Weight | 423.37 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | — |
| SMILES | [B]c1ncnc2c1ccn2C1CCC(CCc2ccc3cc(CCC)c(NC)nc3c2)C1 |
| InChI | InChI=1S/C26H30BN5/c1-3-4-20-15-19-9-7-18(14-23(19)31-25(20)28-2)6-5-17-8-10-21(13-17)32-12-11-22-24(27)29-16-30-26(22)32/h7,9,11-12,14-17,21H,3-6,8,10,13H2,1-2H3,(H,28,31) |
| InChIKey | AYBNNMBRMVZFNS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|