C25H16F4O3S — CID 155734112
(triphenyl-λ4-sulfanyl) 2,3,4,5-tetrafluoro-6-hydroxybenzoate (PubChem CID 155734112) has the molecular formula C25H16F4O3S and a molecular weight of 472.46 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 2,3,4,5-tetrafluoro-6-hydroxybenzoate.
| Compound Name | (triphenyl-λ4-sulfanyl) 2,3,4,5-tetrafluoro-6-hydroxybenzoate |
|---|---|
| PubChem CID | 155734112 |
| Molecular Formula | C25H16F4O3S |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 2,3,4,5-tetrafluoro-6-hydroxybenzoate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccccc1)c1c(O)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H16F4O3S/c26-20-19(24(30)23(29)22(28)21(20)27)25(31)32-33(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,30H |
| InChIKey | AFSVTWLTQGQXBR-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|