C14H28N2O — CID 155734679
ethane;N-[(3E)-hexa-3,5-dien-3-yl]-2,2-dimethylpropanamide;methanimine (PubChem CID 155734679) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;N-[(3E)-hexa-3,5-dien-3-yl]-2,2-dimethylpropanamide;methanimine.
| Compound Name | ethane;N-[(3E)-hexa-3,5-dien-3-yl]-2,2-dimethylpropanamide;methanimine |
|---|---|
| PubChem CID | 155734679 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | ethane;N-[(3E)-hexa-3,5-dien-3-yl]-2,2-dimethylpropanamide;methanimine |
| SMILES | C=C/C=C(\CC)NC(=O)C(C)(C)C.CC.[H]N=C |
| InChI | InChI=1S/C11H19NO.C2H6.CH3N/c1-6-8-9(7-2)12-10(13)11(3,4)5;2*1-2/h6,8H,1,7H2,2-5H3,(H,12,13);1-2H3;2H,1H2/b9-8+;; |
| InChIKey | GYVBVVGXRGVABU-YEUQMBKVSA-N |
| XLogP | 3.92 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|