C25H23KN7O- — CID 155750218
potassium 5-methyl-N-[3-[1-[2-[(4-pyrimidin-5-yl-3H-pyrrol-3-id-2-yl)amino]ethenylamino]ethyl]phenyl]pyridine-3-carboxamide (PubChem CID 155750218) has the molecular formula C25H23KN7O- and a molecular weight of 476.61 g/mol. Its IUPAC name is potassium 5-methyl-N-[3-[1-[2-[(4-pyrimidin-5-yl-3H-pyrrol-3-id-2-yl)amino]ethenylamino]ethyl]phenyl]pyridine-3-carboxamide.
| Compound Name | potassium 5-methyl-N-[3-[1-[2-[(4-pyrimidin-5-yl-3H-pyrrol-3-id-2-yl)amino]ethenylamino]ethyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155750218 |
| Molecular Formula | C25H23KN7O- |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | potassium 5-methyl-N-[3-[1-[2-[(4-pyrimidin-5-yl-3H-pyrrol-3-id-2-yl)amino]ethenylamino]ethyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1cncc(C(=O)Nc2cccc(C(C)N/[C-]=C/Nc3[cH-]c(-c4cncnc4)cn3)c2)c1.[K+] |
| InChI | InChI=1S/C25H23N7O.K/c1-17-8-21(12-26-11-17)25(33)32-23-5-3-4-19(9-23)18(2)29-6-7-30-24-10-20(15-31-24)22-13-27-16-28-14-22;/h3-5,7-16,18,29H,1-2H3,(H,30,31)(H,32,33);/q-2;+1 |
| InChIKey | YWUBQJICEAUREV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|