C23H25F3KN5O — CID 155750143
CID 155750143 (PubChem CID 155750143) has the molecular formula C23H25F3KN5O and a molecular weight of 483.58 g/mol.
| Compound Name | CID 155750143 |
|---|---|
| PubChem CID | 155750143 |
| Molecular Formula | C23H25F3KN5O |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(C)N/[C-]=C/N=C3\[CH-][N+](C)(C)C3)c2)cnc1C(F)(F)F.[K+] |
| InChI | InChI=1S/C23H25F3N5O.K/c1-15-10-18(12-29-21(15)23(24,25)26)22(32)30-19-7-5-6-17(11-19)16(2)27-8-9-28-20-13-31(3,4)14-20;/h5-7,9-13,16,27H,14H2,1-4H3,(H,30,32);/q-1;+1/b28-20+; |
| InChIKey | KYLWJXILPBILIO-UTGUOAKPSA-N |
| XLogP | 1.28 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|