About CID 155750143
CID 155750143 (PubChem CID 155750143) has the molecular formula C23H25F3KN5O
and a molecular weight of 483.58 g/mol.
Molecular Properties
| Compound Name | CID 155750143 |
| PubChem CID | 155750143 |
| Molecular Formula | C23H25F3KN5O |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(C)N/[C-]=C/N=C3\[CH-][N+](C)(C)C3)c2)cnc1C(F)(F)F.[K+] |
| InChI | InChI=1S/C23H25F3N5O.K/c1-15-10-18(12-29-21(15)23(24,25)26)22(32)30-19-7-5-6-17(11-19)16(2)27-8-9-28-20-13-31(3,4)14-20;/h5-7,9-13,16,27H,14H2,1-4H3,(H,30,32);/q-1;+1/b28-20+; |
| InChIKey | KYLWJXILPBILIO-UTGUOAKPSA-N |
| XLogP | 1.28 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 155750143 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155750143?
The IUPAC name of CID 155750143 (CID 155750143) is not available.
What is the SMILES notation for CID 155750143?
The canonical SMILES for CID 155750143 is Cc1cc(C(=O)Nc2cccc(C(C)N/[C-]=C/N=C3\[CH-][N+](C)(C)C3)c2)cnc1C(F)(F)F.[K+].
What is the InChIKey of CID 155750143?
The InChIKey is KYLWJXILPBILIO-UTGUOAKPSA-N. The full InChI is InChI=1S/C23H25F3N5O.K/c1-15-10-18(12-29-21(15)23(24,25)26)22(32)30-19-7-5-6-17(11-19)16(2)27-8-9-28-20-13-31(3,4)14-20;/h5-7,9-13,16,27H,14H2,1-4H3,(H,30,32);/q-1;+1/b28-20+;.
What are the key properties of CID 155750143?
CID 155750143 has a molecular weight of 483.58 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155750143 is sourced from PubChem (CID 155750143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).