C22H21KN6O — CID 155750151
CID 155750151 (PubChem CID 155750151) has the molecular formula C22H21KN6O and a molecular weight of 424.55 g/mol.
| Compound Name | CID 155750151 |
|---|---|
| PubChem CID | 155750151 |
| Molecular Formula | C22H21KN6O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | — |
| SMILES | CC(N/[C-]=C/N=C1/C=[N+](C)[CH-]1)c1cccc(NC(=O)c2cnc3cc[nH]c3c2)c1.[K+] |
| InChI | InChI=1S/C22H21N6O.K/c1-15(23-8-9-24-19-13-28(2)14-19)16-4-3-5-18(10-16)27-22(29)17-11-21-20(26-12-17)6-7-25-21;/h3-7,9-15,23,25H,1-2H3,(H,27,29);/q-1;+1 |
| InChIKey | JALDLUFYHHQXBO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|