C22H20KN6OS- — CID 155750073
potassium N-[3-[1-[2-[(2-methyl-3H-pyrazol-3-id-4-ylidene)amino]ethenylamino]ethyl]phenyl]thieno[3,2-b]pyridine-6-carboxamide (PubChem CID 155750073) has the molecular formula C22H20KN6OS- and a molecular weight of 455.61 g/mol. Its IUPAC name is potassium N-[3-[1-[2-[(2-methyl-3H-pyrazol-3-id-4-ylidene)amino]ethenylamino]ethyl]phenyl]thieno[3,2-b]pyridine-6-carboxamide.
| Compound Name | potassium N-[3-[1-[2-[(2-methyl-3H-pyrazol-3-id-4-ylidene)amino]ethenylamino]ethyl]phenyl]thieno[3,2-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 155750073 |
| Molecular Formula | C22H20KN6OS- |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | potassium N-[3-[1-[2-[(2-methyl-3H-pyrazol-3-id-4-ylidene)amino]ethenylamino]ethyl]phenyl]thieno[3,2-b]pyridine-6-carboxamide |
| SMILES | CC(N/[C-]=C/N=c1/cnn(C)[cH-]1)c1cccc(NC(=O)c2cnc3ccsc3c2)c1.[K+] |
| InChI | InChI=1S/C22H20N6OS.K/c1-15(23-7-8-24-19-13-26-28(2)14-19)16-4-3-5-18(10-16)27-22(29)17-11-21-20(25-12-17)6-9-30-21;/h3-6,8-15,23H,1-2H3,(H,27,29);/q-2;+1/b24-19-; |
| InChIKey | RSUJDRVZLJUWPV-BMGIYVBOSA-N |
| XLogP | 0.53 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|