C22H22KN6O- — CID 155749814
potassium 5-cyclopropyl-N-[3-[1-[2-(1,5-dihydropyrazol-5-id-4-ylideneamino)ethenylamino]ethyl]phenyl]pyridine-3-carboxamide (PubChem CID 155749814) has the molecular formula C22H22KN6O- and a molecular weight of 425.56 g/mol. Its IUPAC name is potassium 5-cyclopropyl-N-[3-[1-[2-(1,5-dihydropyrazol-5-id-4-ylideneamino)ethenylamino]ethyl]phenyl]pyridine-3-carboxamide.
| Compound Name | potassium 5-cyclopropyl-N-[3-[1-[2-(1,5-dihydropyrazol-5-id-4-ylideneamino)ethenylamino]ethyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 155749814 |
| Molecular Formula | C22H22KN6O- |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | potassium 5-cyclopropyl-N-[3-[1-[2-(1,5-dihydropyrazol-5-id-4-ylideneamino)ethenylamino]ethyl]phenyl]pyridine-3-carboxamide |
| SMILES | CC(N/[C-]=C/N=c1/cn[nH][cH-]1)c1cccc(NC(=O)c2cncc(C3CC3)c2)c1.[K+] |
| InChI | InChI=1S/C22H22N6O.K/c1-15(24-7-8-25-21-13-26-27-14-21)17-3-2-4-20(10-17)28-22(29)19-9-18(11-23-12-19)16-5-6-16;/h2-4,8-16,24,26H,5-6H2,1H3,(H,28,29);/q-2;+1/b25-21+; |
| InChIKey | LGAAZNOJABTXEE-JMFMGIQESA-N |
| XLogP | 0.18 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|