C23H24KN5O — CID 155750104
CID 155750104 (PubChem CID 155750104) has the molecular formula C23H24KN5O and a molecular weight of 425.58 g/mol.
| Compound Name | CID 155750104 |
|---|---|
| PubChem CID | 155750104 |
| Molecular Formula | C23H24KN5O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | — |
| SMILES | Cc1cncc(C(=O)Nc2cccc(C(C)N/[C-]=C/N=C3/C=[N+](C4CC4)[CH-]3)c2)c1.[K+] |
| InChI | InChI=1S/C23H24N5O.K/c1-16-10-19(13-24-12-16)23(29)27-20-5-3-4-18(11-20)17(2)25-8-9-26-21-14-28(15-21)22-6-7-22;/h3-5,9-15,17,22,25H,6-7H2,1-2H3,(H,27,29);/q-1;+1 |
| InChIKey | OGCWTOQSDYGWBQ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|