C24H29KN6O — CID 155750122
CID 155750122 (PubChem CID 155750122) has the molecular formula C24H29KN6O and a molecular weight of 456.64 g/mol.
| Compound Name | CID 155750122 |
|---|---|
| PubChem CID | 155750122 |
| Molecular Formula | C24H29KN6O |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(C)N/[C-]=C/N=C3/C=[N+](C)[CH-]3)c2)cnc1NC(C)C.[K+] |
| InChI | InChI=1S/C24H29N6O.K/c1-16(2)28-23-17(3)11-20(13-27-23)24(31)29-21-8-6-7-19(12-21)18(4)25-9-10-26-22-14-30(5)15-22;/h6-8,10-16,18,25H,1-5H3,(H,27,28)(H,29,31);/q-1;+1 |
| InChIKey | DTWQZEHUSSKUQH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|