C24H27ClKN5OS — CID 155750220
CID 155750220 (PubChem CID 155750220) has the molecular formula C24H27ClKN5OS and a molecular weight of 508.13 g/mol.
| Compound Name | CID 155750220 |
|---|---|
| PubChem CID | 155750220 |
| Molecular Formula | C24H27ClKN5OS |
| Molecular Weight | 508.13 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | — |
| SMILES | CC(C)CSc1ncc(C(=O)Nc2cccc(C(C)N/[C-]=C/N=C3/C=[N+](C)[CH-]3)c2)cc1Cl.[K+] |
| InChI | InChI=1S/C24H27ClN5OS.K/c1-16(2)15-32-24-22(25)11-19(12-28-24)23(31)29-20-7-5-6-18(10-20)17(3)26-8-9-27-21-13-30(4)14-21;/h5-7,9-14,16-17,26H,15H2,1-4H3,(H,29,31);/q-1;+1 |
| InChIKey | HNJIXBMSXIRKOG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|