C11H14BNO3 — CID 155761951
N-[4-(1,3,2-dioxaborinan-2-yl)phenyl]acetamide (PubChem CID 155761951) has the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. Its IUPAC name is N-[4-(1,3,2-dioxaborinan-2-yl)phenyl]acetamide.
| Compound Name | N-[4-(1,3,2-dioxaborinan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 155761951 |
| Molecular Formula | C11H14BNO3 |
| Molecular Weight | 219.05 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[4-(1,3,2-dioxaborinan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(B2OCCCO2)cc1 |
| InChI | InChI=1S/C11H14BNO3/c1-9(14)13-11-5-3-10(4-6-11)12-15-7-2-8-16-12/h3-6H,2,7-8H2,1H3,(H,13,14) |
| InChIKey | QXFQKKBTEBQNPR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.05 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|